CAS: 1393124-08-7 | Glucagon Receptor Antagonists-4, >98%, NX23136
SKU: NX23136-1MG
Product Identifiers
| Catalog # | NX23136 |
| CAS Number | 1393124-08-7 |
| PubChem CID | 60151939 |
| Chemical Name | Glucagon Receptor Antagonists-4 |
| IUPAC Name | 3-[[4-[(1S)-1-[3,5-dimethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]phenoxy]butyl]benzoyl]amino]propanoic acid |
| InChI | InChI=1S/C26H28F3N3O4/c1-4-5-22(18-6-8-19(9-7-18)25(35)30-11-10-23(33)34)36-21-12-16(2)24(17(3)13-21)32-15-20(14-31-32)26(27,28)29/h6-9,12-15,22H,4-5,10-11H2,1-3H3,(H,30,35)(H,33,34)/t22-/m0/s1 |
| InChIKey | IBDYYOQKQCCSDP-QFIPXVFZSA-N |
| SMILES | CCC[C@H](Oc1cc(C)c(c(C)c1)n2cc(cn2)C(F)(F)F)c3ccc(cc3)C(=O)NCCC(=O)O |
| MDL Number | MFCD30343861 |
Specification
| MW | 503.5 |
| MF | C26H28F3N3O4 |
| Assay | >98% |
| Product Notes | Glucagon receptor antagonists-4 is an selective antagonist of glucagon receptor. |
| Cat Number | BISN0020 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
