CAS: 1384870-47-6 | DBCO-C6-NHS ester, NX22947
SKU: NX22947-100MG
Product Identifiers
| Catalog # | NX22947 |
| CAS Number | 1384870-47-6 |
| PubChem CID | 86580459 |
| Chemical Name | DBCO-C6-NHS ester |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoate |
| InChI | InChI=1S/C25H22N2O5/c28-22(11-5-6-12-25(31)32-27-23(29)15-16-24(27)30)26-17-20-9-2-1-7-18(20)13-14-19-8-3-4-10-21(19)26/h1-4,7-10H,5-6,11-12,15-17H2 |
| InChIKey | CATTUKBAYDNTEG-UHFFFAOYSA-N |
| SMILES | O=C(CCCCC(=O)N1Cc2ccccc2C#Cc3ccccc13)ON4C(=O)CCC4=O |
| MDL Number | MFCD22380763 |
Specification
| MW | 430.5 |
| MF | C25H22N2O5 |
| Product Notes | DBCO-C6-NHS Ester is an amine-reactive compound, which can be used to modify an amine-containing molecule in organic media. This reagent has limited solubility in aqueous media. The extended 6-carbon atom spacer arm improves solubility in commonly used organic solvents including dichloromethane, chloroform, THF, and ethyl acetate and it also improves derivatization efficiency and stability of conjugates. |
| Special Remarks | Keep Cold |
| Cat Number | BIPG1892 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
