CAS: 103404-87-1 | HEPES hemisodium salt 0.1M packs, NX11941
SKU: NX11941-10 PACK
Product Identifiers
| Catalog # | NX11941 |
| CAS Number | 103404-87-1 |
| PubChem CID | 2724248 |
| Chemical Name | HEPES hemisodium salt 0.1M packs |
| IUPAC Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate |
| InChI | InChI=1S/C8H18N2O4S.Na/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;/h11H,1-8H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | RDZTWEVXRGYCFV-UHFFFAOYSA-M |
| SMILES | [Na+].OCCN1CCN(CCS(=O)(=O)[O-])CC1 |
| MDL Number | MFCD00036463 |
Specification
| MW | 260.29 |
| MF | C8H17N2NaO4S |
| Product Notes | Pre-weighed sachet containing sufficient buffer to create 1 litre of 0.1M solution |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
