CAS: 638-79-9 | Perfluoropentyl iodide, >98%, NX56384
SKU: NX56384-5G
Product Identifiers
| Catalog # | NX56384 |
| CAS Number | 638-79-9 |
| EC Numberr | 211-350-0 |
| PubChem CID | 69494 |
| Chemical Name | Perfluoropentyl iodide |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-5-iodopentane |
| Synonym | Perfluoro-1-iodopentane, 1-Iodo-1,1,2,2,3,3,4,4,5,5,5-undecafluoropentane, 1-Iodoperfluoropentane |
| InChI | InChI=1S/C5F11I/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17 |
| InChIKey | KCEJJSGJNCSQFI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| MDL Number | MFCD08461629 |
Specification
| MW | 395.94 |
| MF | C5F11I |
| Assay | >98% |
| Special Remarks | Stabilised with copper chip |
| Cat Number | PC5264 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
