Product Identifiers
Catalog # | NX22983 |
CAS Number | 138642-62-3 |
PubChem CID | 2734610 |
Chemical Name | 2-Cyanobenzeneboronic acid |
IUPAC Name | (2-cyanophenyl)boronic acid |
Synonym | 2-Boronobenzonitrile |
InChI | InChI=1S/C7H6BNO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,10-11H |
InChIKey | NPLZNDDFVCGRAG-UHFFFAOYSA-N |
SMILES | OB(O)c1ccccc1C#N |
MDL Number | MFCD01632208 |
Specification
MW | 146.94 |
MF | C7H6BNO2 |
Assay | >98% |
Product Notes | Employed in a rhodium-catalyzed [3+2] annulation with alkynes leading to substituted indenones - Org. Lett. 7, 3339, (2005); Useful in the synthesis of substitutes indenones or indanones - Miura, Tomoya; Murakami, Masahiro Org. Lett. 7, 3339-3341, (2005) |
Cat Number | OR10429 |
Manufacturer | Apollo Scientific |
Country of Origin | United Kingdom |