CAS: 123318-82-1 | Clofarabine, free base, NX18435
SKU: NX18435-1G
Product Identifiers
| Catalog # | NX18435 |
| CAS Number | 123318-82-1 |
| PubChem CID | 119182 |
| Chemical Name | Clofarabine, free base |
| IUPAC Name | (2R,3R,4S,5R)-5-(6-amino-2-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| Synonym | (2R,3R,4S,5R)-5-(6-Amino-2-chloropurin-9-yl)-4-fluoro-2-(hydroxymethyl)oxolan-3-ol, 2-Chloro-2-arabino-fluoro-2-deoxyadenosine |
| InChI | InChI=1S/C10H11ClFN5O3/c11-10-15-7(13)5-8(16-10)17(2-14-5)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,15,16)/t3-,4+,6-,9-/m1/s1 |
| InChIKey | WDDPHFBMKLOVOX-AYQXTPAHSA-N |
| SMILES | Nc1nc(Cl)nc2c1ncn2[C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3F |
| MDL Number | MFCD00871077 |
Specification
| MW | 303.68 |
| MF | C10H11ClFN5O3 |
| Product Notes | Clofarabine is a second generation purine nucleoside analogue with multiple properties such as inhibition of ribonucleotide reductase, incorporation into DNA, and induction of apoptosis. |
| Special Remarks | Store at -20¡C |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
